C19H18N2O — CID 113203609
N-phenyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203609) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is N-phenyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-phenyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203609 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-phenyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C19H18N2O/c22-19(20-14-6-2-1-3-7-14)13-10-11-18-16(12-13)15-8-4-5-9-17(15)21-18/h1-9,13,21H,10-12H2,(H,20,22) |
| InChIKey | QRXNCHZRHFYFGV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|