C16H18N2O — CID 113203525
N-prop-2-enyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203525) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is N-prop-2-enyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-prop-2-enyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203525 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-prop-2-enyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | C=CCNC(=O)C1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C16H18N2O/c1-2-9-17-16(19)11-7-8-15-13(10-11)12-5-3-4-6-14(12)18-15/h2-6,11,18H,1,7-10H2,(H,17,19) |
| InChIKey | XRPIDSPBCZAEPI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|