C20H19ClN2O — CID 113203629
N-(3-chloro-2-methylphenyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203629) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203629 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C20H19ClN2O/c1-12-16(21)6-4-8-17(12)23-20(24)13-9-10-19-15(11-13)14-5-2-3-7-18(14)22-19/h2-8,13,22H,9-11H2,1H3,(H,23,24) |
| InChIKey | WKBBNYZBGVIOOQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|