C20H16F4N2O — CID 113203795
6-fluoro-N-[2-(trifluoromethyl)phenyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203795) has the molecular formula C20H16F4N2O and a molecular weight of 376.35 g/mol. Its IUPAC name is 6-fluoro-N-[2-(trifluoromethyl)phenyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | 6-fluoro-N-[2-(trifluoromethyl)phenyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203795 |
| Molecular Formula | C20H16F4N2O |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 6-fluoro-N-[2-(trifluoromethyl)phenyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C20H16F4N2O/c21-12-6-8-17-14(10-12)13-9-11(5-7-16(13)25-17)19(27)26-18-4-2-1-3-15(18)20(22,23)24/h1-4,6,8,10-11,25H,5,7,9H2,(H,26,27) |
| InChIKey | MJKZTFZSZKDYHT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|