C23H25FN2O — CID 91126905
N-benzyl-6-fluoro-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 91126905) has the molecular formula C23H25FN2O and a molecular weight of 364.46 g/mol. Its IUPAC name is N-benzyl-6-fluoro-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-benzyl-6-fluoro-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 91126905 |
| Molecular Formula | C23H25FN2O |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-benzyl-6-fluoro-N-propan-2-yl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C23H25FN2O/c1-15(2)26(14-16-6-4-3-5-7-16)23(27)17-8-10-21-19(12-17)20-13-18(24)9-11-22(20)25-21/h3-7,9,11,13,15,17,25H,8,10,12,14H2,1-2H3 |
| InChIKey | HVAQQLLJUBXBSE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|