C21H21FN2O — CID 113203728
6-fluoro-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203728) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 6-fluoro-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | 6-fluoro-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203728 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 6-fluoro-N-(2-phenylethyl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C21H21FN2O/c22-16-7-9-20-18(13-16)17-12-15(6-8-19(17)24-20)21(25)23-11-10-14-4-2-1-3-5-14/h1-5,7,9,13,15,24H,6,8,10-12H2,(H,23,25) |
| InChIKey | HYMIRYGPEQCVOX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|