C17H21FN2O — CID 113203690
N-butyl-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203690) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is N-butyl-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-butyl-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203690 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-butyl-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C17H21FN2O/c1-2-3-8-19-17(21)11-4-6-15-13(9-11)14-10-12(18)5-7-16(14)20-15/h5,7,10-11,20H,2-4,6,8-9H2,1H3,(H,19,21) |
| InChIKey | PCYVOZNSRXFINN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|