C20H18ClFN2O2 — CID 113203782
N-(5-chloro-2-methoxyphenyl)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203782) has the molecular formula C20H18ClFN2O2 and a molecular weight of 372.83 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203782 |
| Molecular Formula | C20H18ClFN2O2 |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-6-fluoro-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C20H18ClFN2O2/c1-26-19-7-3-12(21)9-18(19)24-20(25)11-2-5-16-14(8-11)15-10-13(22)4-6-17(15)23-16/h3-4,6-7,9-11,23H,2,5,8H2,1H3,(H,24,25) |
| InChIKey | VDVACKBWKLPGNP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|