C22H23ClN2O2 — CID 113203864
6-chloro-N-[2-(2-methoxyphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203864) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 6-chloro-N-[2-(2-methoxyphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(2-methoxyphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203864 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 6-chloro-N-[2-(2-methoxyphenyl)ethyl]-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)C1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C22H23ClN2O2/c1-27-21-5-3-2-4-14(21)10-11-24-22(26)15-6-8-19-17(12-15)18-13-16(23)7-9-20(18)25-19/h2-5,7,9,13,15,25H,6,8,10-12H2,1H3,(H,24,26) |
| InChIKey | ZSQRZVPIWQECLC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|