C22H24N2O3 — CID 113204168
N-(3,4-dimethoxyphenyl)-6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113204168) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113204168 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCc3[nH]c4ccc(C)cc4c3C2)cc1OC |
| InChI | InChI=1S/C22H24N2O3/c1-13-4-7-18-16(10-13)17-11-14(5-8-19(17)24-18)22(25)23-15-6-9-20(26-2)21(12-15)27-3/h4,6-7,9-10,12,14,24H,5,8,11H2,1-3H3,(H,23,25) |
| InChIKey | HIURSIYFIFGDKV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|