C22H29N3O3 — CID 113204130
ethyl 4-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 113204130) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 4-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113204130 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl 4-[(6-methyl-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2CCc3[nH]c4ccc(C)cc4c3C2)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-28-22(27)25-10-8-16(9-11-25)23-21(26)15-5-7-20-18(13-15)17-12-14(2)4-6-19(17)24-20/h4,6,12,15-16,24H,3,5,7-11,13H2,1-2H3,(H,23,26) |
| InChIKey | JHCKLXOZLJUZPA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|