C18H22ClN3O3 — CID 113204728
ethyl 4-[(5-chloro-3-methyl-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 113204728) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is ethyl 4-[(5-chloro-3-methyl-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(5-chloro-3-methyl-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113204728 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl 4-[(5-chloro-3-methyl-1H-indole-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2[nH]c3ccc(Cl)cc3c2C)CC1 |
| InChI | InChI=1S/C18H22ClN3O3/c1-3-25-18(24)22-8-6-13(7-9-22)20-17(23)16-11(2)14-10-12(19)4-5-15(14)21-16/h4-5,10,13,21H,3,6-9H2,1-2H3,(H,20,23) |
| InChIKey | OSPXURMDBFVWBK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|