C17H22Cl2N2O3 — CID 108561579
butyl 4-[(2,5-dichlorobenzoyl)amino]piperidine-1-carboxylate (PubChem CID 108561579) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is butyl 4-[(2,5-dichlorobenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | butyl 4-[(2,5-dichlorobenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108561579 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | butyl 4-[(2,5-dichlorobenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(NC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-2-3-10-24-17(23)21-8-6-13(7-9-21)20-16(22)14-11-12(18)4-5-15(14)19/h4-5,11,13H,2-3,6-10H2,1H3,(H,20,22) |
| InChIKey | WVSUFPUCBDDYRJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|