C15H17Cl3N2O2 — CID 108561573
2,5-dichloro-N-[1-(3-chloropropanoyl)piperidin-4-yl]benzamide (PubChem CID 108561573) has the molecular formula C15H17Cl3N2O2 and a molecular weight of 363.67 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(3-chloropropanoyl)piperidin-4-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[1-(3-chloropropanoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108561573 |
| Molecular Formula | C15H17Cl3N2O2 |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2,5-dichloro-N-[1-(3-chloropropanoyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)CCCl)CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H17Cl3N2O2/c16-6-3-14(21)20-7-4-11(5-8-20)19-15(22)12-9-10(17)1-2-13(12)18/h1-2,9,11H,3-8H2,(H,19,22) |
| InChIKey | FJCOQTZFBLDWAU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|