C17H22Cl2N2O4 — CID 108567011
2,4-dichloro-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide (PubChem CID 108567011) has the molecular formula C17H22Cl2N2O4 and a molecular weight of 389.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108567011 |
| Molecular Formula | C17H22Cl2N2O4 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide |
| SMILES | COCCOCC(=O)N1CCC(NC(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O4/c1-24-8-9-25-11-16(22)21-6-4-13(5-7-21)20-17(23)14-3-2-12(18)10-15(14)19/h2-3,10,13H,4-9,11H2,1H3,(H,20,23) |
| InChIKey | CVLVKTZIXLNDJQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|