C18H25ClN2O5 — CID 108552287
5-chloro-2-methoxy-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide (PubChem CID 108552287) has the molecular formula C18H25ClN2O5 and a molecular weight of 384.86 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108552287 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-chloro-2-methoxy-N-[1-[2-(2-methoxyethoxy)acetyl]piperidin-4-yl]benzamide |
| SMILES | COCCOCC(=O)N1CCC(NC(=O)c2cc(Cl)ccc2OC)CC1 |
| InChI | InChI=1S/C18H25ClN2O5/c1-24-9-10-26-12-17(22)21-7-5-14(6-8-21)20-18(23)15-11-13(19)3-4-16(15)25-2/h3-4,11,14H,5-10,12H2,1-2H3,(H,20,23) |
| InChIKey | FLZLHVAFHAJCHC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|