C11H13ClN2O2 — CID 66186533
N-(azetidin-3-yl)-5-chloro-2-methoxybenzamide (PubChem CID 66186533) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is N-(azetidin-3-yl)-5-chloro-2-methoxybenzamide.
| Compound Name | N-(azetidin-3-yl)-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 66186533 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | N-(azetidin-3-yl)-5-chloro-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC1CNC1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-16-10-3-2-7(12)4-9(10)11(15)14-8-5-13-6-8/h2-4,8,13H,5-6H2,1H3,(H,14,15) |
| InChIKey | XNPMUJAEVNAQAN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |