C20H21ClN2O5 — CID 108552291
5-chloro-N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-methoxybenzamide (PubChem CID 108552291) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is 5-chloro-N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 108552291 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 5-chloro-N-[1-(3,5-dihydroxybenzoyl)piperidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC1CCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C20H21ClN2O5/c1-28-18-3-2-13(21)10-17(18)19(26)22-14-4-6-23(7-5-14)20(27)12-8-15(24)11-16(25)9-12/h2-3,8-11,14,24-25H,4-7H2,1H3,(H,22,26) |
| InChIKey | RKVHLZLLKKKWJB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |