C22H25ClN2O5 — CID 108552221
5-chloro-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2-methoxybenzamide (PubChem CID 108552221) has the molecular formula C22H25ClN2O5 and a molecular weight of 432.90 g/mol. Its IUPAC name is 5-chloro-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 108552221 |
| Molecular Formula | C22H25ClN2O5 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 5-chloro-N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC1CCN(C(=O)c2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C22H25ClN2O5/c1-28-17-8-7-14(23)13-16(17)21(26)24-15-9-11-25(12-10-15)22(27)20-18(29-2)5-4-6-19(20)30-3/h4-8,13,15H,9-12H2,1-3H3,(H,24,26) |
| InChIKey | PFXGFIXGBKHANN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |