C21H21F3N2O4 — CID 108556755
N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide (PubChem CID 108556755) has the molecular formula C21H21F3N2O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108556755 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[1-(2,6-dimethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(NC(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H21F3N2O4/c1-29-15-4-3-5-16(30-2)17(15)21(28)26-10-8-12(9-11-26)25-20(27)13-6-7-14(22)19(24)18(13)23/h3-7,12H,8-11H2,1-2H3,(H,25,27) |
| InChIKey | VCTIOXJLRDPHKV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|