C21H21F3N2O4 — CID 108556719
2-(2-methoxyphenoxy)-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]acetamide (PubChem CID 108556719) has the molecular formula C21H21F3N2O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108556719 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]acetamide |
| SMILES | COc1ccccc1OCC(=O)NC1CCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H21F3N2O4/c1-29-16-4-2-3-5-17(16)30-12-18(27)25-13-8-10-26(11-9-13)21(28)14-6-7-15(22)20(24)19(14)23/h2-7,13H,8-12H2,1H3,(H,25,27) |
| InChIKey | CWWRASRQYKITOX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|