C25H32N2O4 — CID 108556694
N-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 108556694) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 108556694 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-[1-(4-tert-butylbenzoyl)piperidin-4-yl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)NC1CCN(C(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H32N2O4/c1-25(2,3)19-11-9-18(10-12-19)24(29)27-15-13-20(14-16-27)26-23(28)17-31-22-8-6-5-7-21(22)30-4/h5-12,20H,13-17H2,1-4H3,(H,26,28) |
| InChIKey | BSTZFMDAZGQVAH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |