C23H26N2O6 — CID 108556647
[3-[4-[[2-(2-methoxyphenoxy)acetyl]amino]piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108556647) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is [3-[4-[[2-(2-methoxyphenoxy)acetyl]amino]piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[[2-(2-methoxyphenoxy)acetyl]amino]piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108556647 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [3-[4-[[2-(2-methoxyphenoxy)acetyl]amino]piperidine-1-carbonyl]phenyl] acetate |
| SMILES | COc1ccccc1OCC(=O)NC1CCN(C(=O)c2cccc(OC(C)=O)c2)CC1 |
| InChI | InChI=1S/C23H26N2O6/c1-16(26)31-19-7-5-6-17(14-19)23(28)25-12-10-18(11-13-25)24-22(27)15-30-21-9-4-3-8-20(21)29-2/h3-9,14,18H,10-13,15H2,1-2H3,(H,24,27) |
| InChIKey | AGZXZTNKRGGDBK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|