C18H23ClN2O4 — CID 108563337
[3-[4-(4-chlorobutanoylamino)piperidine-1-carbonyl]phenyl] acetate (PubChem CID 108563337) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is [3-[4-(4-chlorobutanoylamino)piperidine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-(4-chlorobutanoylamino)piperidine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108563337 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [3-[4-(4-chlorobutanoylamino)piperidine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCC(NC(=O)CCCCl)CC2)c1 |
| InChI | InChI=1S/C18H23ClN2O4/c1-13(22)25-16-5-2-4-14(12-16)18(24)21-10-7-15(8-11-21)20-17(23)6-3-9-19/h2,4-5,12,15H,3,6-11H2,1H3,(H,20,23) |
| InChIKey | RCPPINAKIMGQSP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|