C24H28N2O6 — CID 108548529
[3-[[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 108548529) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is [3-[[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108548529 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [3-[[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | CCOc1ccccc1OCC(=O)N1CCC(NC(=O)c2cccc(OC(C)=O)c2)CC1 |
| InChI | InChI=1S/C24H28N2O6/c1-3-30-21-9-4-5-10-22(21)31-16-23(28)26-13-11-19(12-14-26)25-24(29)18-7-6-8-20(15-18)32-17(2)27/h4-10,15,19H,3,11-14,16H2,1-2H3,(H,25,29) |
| InChIKey | XIINPKNXJAMTRQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|