C21H24N2O4S — CID 108549795
2,6-dimethoxy-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide (PubChem CID 108549795) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108549795 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2,6-dimethoxy-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC1CCN(C(=O)c2ccccc2S)CC1 |
| InChI | InChI=1S/C21H24N2O4S/c1-26-16-7-5-8-17(27-2)19(16)20(24)22-14-10-12-23(13-11-14)21(25)15-6-3-4-9-18(15)28/h3-9,14,28H,10-13H2,1-2H3,(H,22,24) |
| InChIKey | WTWQVKWWPXZKDB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|