C20H20Cl2N2O3S — CID 108561636
N-[1-(3,6-dichloro-2-methoxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide (PubChem CID 108561636) has the molecular formula C20H20Cl2N2O3S and a molecular weight of 439.36 g/mol. Its IUPAC name is N-[1-(3,6-dichloro-2-methoxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide.
| Compound Name | N-[1-(3,6-dichloro-2-methoxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 108561636 |
| Molecular Formula | C20H20Cl2N2O3S |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[1-(3,6-dichloro-2-methoxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)N1CCC(NC(=O)c2ccccc2S)CC1 |
| InChI | InChI=1S/C20H20Cl2N2O3S/c1-27-18-15(22)7-6-14(21)17(18)20(26)24-10-8-12(9-11-24)23-19(25)13-4-2-3-5-16(13)28/h2-7,12,28H,8-11H2,1H3,(H,23,25) |
| InChIKey | BUNDKTHHMXUPQP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|