C19H20N2O3S — CID 108554761
N-[1-(3-hydroxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide (PubChem CID 108554761) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[1-(3-hydroxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide.
| Compound Name | N-[1-(3-hydroxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 108554761 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[1-(3-hydroxybenzoyl)piperidin-4-yl]-2-sulfanylbenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2cccc(O)c2)CC1)c1ccccc1S |
| InChI | InChI=1S/C19H20N2O3S/c22-15-5-3-4-13(12-15)19(24)21-10-8-14(9-11-21)20-18(23)16-6-1-2-7-17(16)25/h1-7,12,14,22,25H,8-11H2,(H,20,23) |
| InChIKey | JLZKUQAZACKCLI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|