C20H23N3O4S2 — CID 108554693
N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-sulfanylbenzamide (PubChem CID 108554693) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-sulfanylbenzamide.
| Compound Name | N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 108554693 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-sulfanylbenzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)N2CCC(NC(=O)c3ccccc3S)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-29(26,27)22-16-8-6-14(7-9-16)20(25)23-12-10-15(11-13-23)21-19(24)17-4-2-3-5-18(17)28/h2-9,15,22,28H,10-13H2,1H3,(H,21,24) |
| InChIKey | ZWQWVUDPMWPRNE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|