C18H27N3O6S — CID 108557729
N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-(2-methoxyethoxy)acetamide (PubChem CID 108557729) has the molecular formula C18H27N3O6S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 108557729 |
| Molecular Formula | C18H27N3O6S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[1-[4-(methanesulfonamido)benzoyl]piperidin-4-yl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NC1CCN(C(=O)c2ccc(NS(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O6S/c1-26-11-12-27-13-17(22)19-15-7-9-21(10-8-15)18(23)14-3-5-16(6-4-14)20-28(2,24)25/h3-6,15,20H,7-13H2,1-2H3,(H,19,22) |
| InChIKey | KUEUWEHDSQFEFI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|