C21H24N2O2S — CID 108557610
3,4-dimethyl-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide (PubChem CID 108557610) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is 3,4-dimethyl-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 3,4-dimethyl-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108557610 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3,4-dimethyl-N-[1-(2-sulfanylbenzoyl)piperidin-4-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)c3ccccc3S)CC2)cc1C |
| InChI | InChI=1S/C21H24N2O2S/c1-14-7-8-16(13-15(14)2)20(24)22-17-9-11-23(12-10-17)21(25)18-5-3-4-6-19(18)26/h3-8,13,17,26H,9-12H2,1-2H3,(H,22,24) |
| InChIKey | BFSNMKWPKRWOCS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|