C21H21F3N2O3 — CID 108556775
N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide (PubChem CID 108556775) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108556775 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[1-(4-ethoxybenzoyl)piperidin-4-yl]-2,3,4-trifluorobenzamide |
| SMILES | CCOc1ccc(C(=O)N2CCC(NC(=O)c3ccc(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C21H21F3N2O3/c1-2-29-15-5-3-13(4-6-15)21(28)26-11-9-14(10-12-26)25-20(27)16-7-8-17(22)19(24)18(16)23/h3-8,14H,2,9-12H2,1H3,(H,25,27) |
| InChIKey | OURQAITZGLYLKB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|