C23H26Cl2N2O3 — CID 108554600
2,5-dichloro-N-[1-[4-(2-methylphenoxy)butanoyl]piperidin-4-yl]benzamide (PubChem CID 108554600) has the molecular formula C23H26Cl2N2O3 and a molecular weight of 449.38 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-[4-(2-methylphenoxy)butanoyl]piperidin-4-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[1-[4-(2-methylphenoxy)butanoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108554600 |
| Molecular Formula | C23H26Cl2N2O3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2,5-dichloro-N-[1-[4-(2-methylphenoxy)butanoyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccccc1OCCCC(=O)N1CCC(NC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C23H26Cl2N2O3/c1-16-5-2-3-6-21(16)30-14-4-7-22(28)27-12-10-18(11-13-27)26-23(29)19-15-17(24)8-9-20(19)25/h2-3,5-6,8-9,15,18H,4,7,10-14H2,1H3,(H,26,29) |
| InChIKey | MGNBOCCOUBCVNM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|