C22H24Cl2N2O3 — CID 108554594
2,5-dichloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide (PubChem CID 108554594) has the molecular formula C22H24Cl2N2O3 and a molecular weight of 435.35 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108554594 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2,5-dichloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide |
| SMILES | Cc1cccc(OCC(=O)N2CCC(NC(=O)c3cc(Cl)ccc3Cl)CC2)c1C |
| InChI | InChI=1S/C22H24Cl2N2O3/c1-14-4-3-5-20(15(14)2)29-13-21(27)26-10-8-17(9-11-26)25-22(28)18-12-16(23)6-7-19(18)24/h3-7,12,17H,8-11,13H2,1-2H3,(H,25,28) |
| InChIKey | JTLSJPDDCGXJRX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |