C22H25ClN2O3 — CID 108550145
4-chloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide (PubChem CID 108550145) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108550145 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-chloro-N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]benzamide |
| SMILES | Cc1cccc(OCC(=O)N2CCC(NC(=O)c3ccc(Cl)cc3)CC2)c1C |
| InChI | InChI=1S/C22H25ClN2O3/c1-15-4-3-5-20(16(15)2)28-14-21(26)25-12-10-19(11-13-25)24-22(27)17-6-8-18(23)9-7-17/h3-9,19H,10-14H2,1-2H3,(H,24,27) |
| InChIKey | UGQGBOJGVGYYQS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |