C22H26N2O6 — CID 108551499
N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide (PubChem CID 108551499) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108551499 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[1-[2-(2,3-dimethylphenoxy)acetyl]piperidin-4-yl]-3,4,5-trihydroxybenzamide |
| SMILES | Cc1cccc(OCC(=O)N2CCC(NC(=O)c3cc(O)c(O)c(O)c3)CC2)c1C |
| InChI | InChI=1S/C22H26N2O6/c1-13-4-3-5-19(14(13)2)30-12-20(27)24-8-6-16(7-9-24)23-22(29)15-10-17(25)21(28)18(26)11-15/h3-5,10-11,16,25-26,28H,6-9,12H2,1-2H3,(H,23,29) |
| InChIKey | NWHFNMNLTRFDDY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|