C18H24Cl2N2O2 — CID 108554619
2,5-dichloro-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide (PubChem CID 108554619) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108554619 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2,5-dichloro-N-[1-(2-ethylbutanoyl)piperidin-4-yl]benzamide |
| SMILES | CCC(CC)C(=O)N1CCC(NC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-3-12(4-2)18(24)22-9-7-14(8-10-22)21-17(23)15-11-13(19)5-6-16(15)20/h5-6,11-12,14H,3-4,7-10H2,1-2H3,(H,21,23) |
| InChIKey | RTYFBYQFWRYOEE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |