C21H22Cl2N2O2 — CID 108554637
2,5-dichloro-N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]benzamide (PubChem CID 108554637) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108554637 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2,5-dichloro-N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]benzamide |
| SMILES | Cc1ccc(C(=O)N2CCC(NC(=O)c3cc(Cl)ccc3Cl)CC2)cc1C |
| InChI | InChI=1S/C21H22Cl2N2O2/c1-13-3-4-15(11-14(13)2)21(27)25-9-7-17(8-10-25)24-20(26)18-12-16(22)5-6-19(18)23/h3-6,11-12,17H,7-10H2,1-2H3,(H,24,26) |
| InChIKey | RTYMQSODUFPJLV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |