C23H27ClN6O2 — CID 42540416
5-chloro-3-methyl-N-[4-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]cyclohexyl]-1H-indole-2-carboxamide (PubChem CID 42540416) has the molecular formula C23H27ClN6O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is 5-chloro-3-methyl-N-[4-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]cyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-methyl-N-[4-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]cyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 42540416 |
| Molecular Formula | C23H27ClN6O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 5-chloro-3-methyl-N-[4-[4-(pyrrolidine-1-carbonyl)triazol-1-yl]cyclohexyl]-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCC(n3cc(C(=O)N4CCCC4)nn3)CC2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H27ClN6O2/c1-14-18-12-15(24)4-9-19(18)26-21(14)22(31)25-16-5-7-17(8-6-16)30-13-20(27-28-30)23(32)29-10-2-3-11-29/h4,9,12-13,16-17,26H,2-3,5-8,10-11H2,1H3,(H,25,31) |
| InChIKey | SEHCLNNBFKOEBO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|