C23H24ClN3O3 — CID 25276857
(5-chloro-3-methyl-1H-indol-2-yl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone (PubChem CID 25276857) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is (5-chloro-3-methyl-1H-indol-2-yl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone.
| Compound Name | (5-chloro-3-methyl-1H-indol-2-yl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 25276857 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (5-chloro-3-methyl-1H-indol-2-yl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCC[C@H](Nc3ccc4c(c3)OCCO4)C2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H24ClN3O3/c1-14-18-11-15(24)4-6-19(18)26-22(14)23(28)27-8-2-3-17(13-27)25-16-5-7-20-21(12-16)30-10-9-29-20/h4-7,11-12,17,25-26H,2-3,8-10,13H2,1H3/t17-/m0/s1 |
| InChIKey | HKFFNOZXSQNPAB-KRWDZBQOSA-N |
| XLogP | 4.62 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|