C19H28N2O4 — CID 95714486
2-butoxy-1-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]ethanone (PubChem CID 95714486) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-butoxy-1-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]ethanone.
| Compound Name | 2-butoxy-1-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95714486 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-butoxy-1-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]ethanone |
| SMILES | CCCCOCC(=O)N1CCC[C@H](Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C19H28N2O4/c1-2-3-9-23-14-19(22)21-8-4-5-16(13-21)20-15-6-7-17-18(12-15)25-11-10-24-17/h6-7,12,16,20H,2-5,8-11,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | HZBKGFYMPUHFKS-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|