C21H22N2O5 — CID 42517146
1,3-benzodioxol-5-yl-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone (PubChem CID 42517146) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42517146 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCC[C@H](Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C21H22N2O5/c24-21(14-3-5-18-19(10-14)28-13-27-18)23-7-1-2-16(12-23)22-15-4-6-17-20(11-15)26-9-8-25-17/h3-6,10-11,16,22H,1-2,7-9,12-13H2/t16-/m0/s1 |
| InChIKey | RPOQFGZWZXFBEJ-INIZCTEOSA-N |
| XLogP | 2.90 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|