C19H18F2N2O3 — CID 45178750
1,3-benzodioxol-5-yl-[3-(3,4-difluoroanilino)piperidin-1-yl]methanone (PubChem CID 45178750) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[3-(3,4-difluoroanilino)piperidin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[3-(3,4-difluoroanilino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 45178750 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[3-(3,4-difluoroanilino)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCCC(Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C19H18F2N2O3/c20-15-5-4-13(9-16(15)21)22-14-2-1-7-23(10-14)19(24)12-3-6-17-18(8-12)26-11-25-17/h3-6,8-9,14,22H,1-2,7,10-11H2 |
| InChIKey | HYMBHKDCHAQBSP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |