C21H19F2N3O — CID 42292653
[(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]-quinolin-6-ylmethanone (PubChem CID 42292653) has the molecular formula C21H19F2N3O and a molecular weight of 367.40 g/mol. Its IUPAC name is [(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]-quinolin-6-ylmethanone.
| Compound Name | [(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 42292653 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [(3S)-3-(3,4-difluoroanilino)piperidin-1-yl]-quinolin-6-ylmethanone |
| SMILES | O=C(c1ccc2ncccc2c1)N1CCC[C@H](Nc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C21H19F2N3O/c22-18-7-6-16(12-19(18)23)25-17-4-2-10-26(13-17)21(27)15-5-8-20-14(11-15)3-1-9-24-20/h1,3,5-9,11-12,17,25H,2,4,10,13H2/t17-/m0/s1 |
| InChIKey | JIVYRHSFYQIMKA-KRWDZBQOSA-N |
| XLogP | 4.23 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |