C14H16F2N2O2 — CID 47250997
N-[1-(3,4-difluorobenzoyl)piperidin-3-yl]acetamide (PubChem CID 47250997) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is N-[1-(3,4-difluorobenzoyl)piperidin-3-yl]acetamide.
| Compound Name | N-[1-(3,4-difluorobenzoyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 47250997 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-[1-(3,4-difluorobenzoyl)piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(C(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H16F2N2O2/c1-9(19)17-11-3-2-6-18(8-11)14(20)10-4-5-12(15)13(16)7-10/h4-5,7,11H,2-3,6,8H2,1H3,(H,17,19) |
| InChIKey | GNIZYAAAAIACQD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |