C14H17F2N3O2 — CID 61108163
N-[1-(5-amino-2,4-difluorobenzoyl)piperidin-3-yl]acetamide (PubChem CID 61108163) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[1-(5-amino-2,4-difluorobenzoyl)piperidin-3-yl]acetamide.
| Compound Name | N-[1-(5-amino-2,4-difluorobenzoyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 61108163 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[1-(5-amino-2,4-difluorobenzoyl)piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(C(=O)c2cc(N)c(F)cc2F)C1 |
| InChI | InChI=1S/C14H17F2N3O2/c1-8(20)18-9-3-2-4-19(7-9)14(21)10-5-13(17)12(16)6-11(10)15/h5-6,9H,2-4,7,17H2,1H3,(H,18,20) |
| InChIKey | KXEZYZQTOIHODG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|