C13H15F2N3O2 — CID 105380881
N-[1-(2,3-difluoropyridine-4-carbonyl)piperidin-3-yl]acetamide (PubChem CID 105380881) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is N-[1-(2,3-difluoropyridine-4-carbonyl)piperidin-3-yl]acetamide.
| Compound Name | N-[1-(2,3-difluoropyridine-4-carbonyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 105380881 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[1-(2,3-difluoropyridine-4-carbonyl)piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(C(=O)c2ccnc(F)c2F)C1 |
| InChI | InChI=1S/C13H15F2N3O2/c1-8(19)17-9-3-2-6-18(7-9)13(20)10-4-5-16-12(15)11(10)14/h4-5,9H,2-3,6-7H2,1H3,(H,17,19) |
| InChIKey | YXJIPHBTCQPXKE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|