C10H10F2N2O2 — CID 105381176
(2,3-difluoro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone (PubChem CID 105381176) has the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. Its IUPAC name is (2,3-difluoro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone.
| Compound Name | (2,3-difluoro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 105381176 |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (2,3-difluoro-4-pyridinyl)-(3-hydroxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccnc(F)c1F)N1CCC(O)C1 |
| InChI | InChI=1S/C10H10F2N2O2/c11-8-7(1-3-13-9(8)12)10(16)14-4-2-6(15)5-14/h1,3,6,15H,2,4-5H2 |
| InChIKey | XYGFJFKEFIYOBD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|