C20H20F2N2O3 — CID 24793090
methyl 4-[3-(3,4-difluoroanilino)piperidine-1-carbonyl]benzoate (PubChem CID 24793090) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl 4-[3-(3,4-difluoroanilino)piperidine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[3-(3,4-difluoroanilino)piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 24793090 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 4-[3-(3,4-difluoroanilino)piperidine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCCC(Nc3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C20H20F2N2O3/c1-27-20(26)14-6-4-13(5-7-14)19(25)24-10-2-3-16(12-24)23-15-8-9-17(21)18(22)11-15/h4-9,11,16,23H,2-3,10,12H2,1H3 |
| InChIKey | VSTNJCRAUXZSNE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |