C20H20ClFN2O3 — CID 42198210
(5-chloro-2-fluorophenyl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone (PubChem CID 42198210) has the molecular formula C20H20ClFN2O3 and a molecular weight of 390.84 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42198210 |
| Molecular Formula | C20H20ClFN2O3 |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1F)N1CCC[C@H](Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C20H20ClFN2O3/c21-13-3-5-17(22)16(10-13)20(25)24-7-1-2-15(12-24)23-14-4-6-18-19(11-14)27-9-8-26-18/h3-6,10-11,15,23H,1-2,7-9,12H2/t15-/m0/s1 |
| InChIKey | HAAGQPIYFZXBGG-HNNXBMFYSA-N |
| XLogP | 3.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|